C37H35Cl2N5O5 — CID 54186816
[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-phenylcarbamic acid (PubChem CID 54186816) has the molecular formula C37H35Cl2N5O5 and a molecular weight of 700.62 g/mol. Its IUPAC name is [4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-phenylcarbamic acid.
| Compound Name | [4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-phenylcarbamic acid |
|---|---|
| PubChem CID | 54186816 |
| Molecular Formula | C37H35Cl2N5O5 |
| Molecular Weight | 700.62 g/mol |
| Exact Mass | 699.20 |
| IUPAC Name | [4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-phenylcarbamic acid |
| SMILES | O=C(O)N(c1ccccc1)c1ccc(N2CCN(c3ccc(OC[C@@H]4CO[C@@](Cn5ccnc5)(c5ccc(Cl)cc5Cl)O4)cc3)CC2)cc1 |
| InChI | InChI=1S/C37H35Cl2N5O5/c38-27-6-15-34(35(39)22-27)37(25-41-17-16-40-26-41)48-24-33(49-37)23-47-32-13-11-29(12-14-32)43-20-18-42(19-21-43)28-7-9-31(10-8-28)44(36(45)46)30-4-2-1-3-5-30/h1-17,22,26,33H,18-21,23-25H2,(H,45,46)/t33-,37-/m1/s1 |
| InChIKey | PFQUGBDNSSEWGA-PZSMLTKBSA-N |
| XLogP | 7.68 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.62 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|