C26H26Cl4N4O4 — CID 54412867
2,2-dichloro-1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone (PubChem CID 54412867) has the molecular formula C26H26Cl4N4O4 and a molecular weight of 600.33 g/mol. Its IUPAC name is 2,2-dichloro-1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 54412867 |
| Molecular Formula | C26H26Cl4N4O4 |
| Molecular Weight | 600.33 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | 2,2-dichloro-1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone |
| SMILES | O=C(C(Cl)Cl)N1CCN(c2ccc(OC[C@@H]3CO[C@@](Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
| InChI | InChI=1S/C26H26Cl4N4O4/c27-18-1-6-22(23(28)13-18)26(16-32-8-7-31-17-32)37-15-21(38-26)14-36-20-4-2-19(3-5-20)33-9-11-34(12-10-33)25(35)24(29)30/h1-8,13,17,21,24H,9-12,14-16H2/t21-,26-/m1/s1 |
| InChIKey | VVIZSSYIHRZQEK-QFQXNSOFSA-N |
| XLogP | 4.99 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|