C29H32Cl2N6O4 — CID 66692525
1-[4-[4-[[(2R,4S)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone;1H-imidazole (PubChem CID 66692525) has the molecular formula C29H32Cl2N6O4 and a molecular weight of 599.52 g/mol. Its IUPAC name is 1-[4-[4-[[(2R,4S)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone;1H-imidazole.
| Compound Name | 1-[4-[4-[[(2R,4S)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone;1H-imidazole |
|---|---|
| PubChem CID | 66692525 |
| Molecular Formula | C29H32Cl2N6O4 |
| Molecular Weight | 599.52 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | 1-[4-[4-[[(2R,4S)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone;1H-imidazole |
| SMILES | CC(=O)N1CCN(c2ccc(OC[C@H]3CO[C@](Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1.c1c[nH]cn1 |
| InChI | InChI=1S/C26H28Cl2N4O4.C3H4N2/c1-19(33)31-10-12-32(13-11-31)21-3-5-22(6-4-21)34-15-23-16-35-26(36-23,17-30-9-8-29-18-30)24-7-2-20(27)14-25(24)28;1-2-5-3-4-1/h2-9,14,18,23H,10-13,15-17H2,1H3;1-3H,(H,4,5)/t23-,26-;/m0./s1 |
| InChIKey | KNHCZATWDMBVTP-MHUAFMOUSA-N |
| XLogP | 4.62 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|