C26H30Cl4N4O4 — CID 70539730
1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone;dihydrochloride (PubChem CID 70539730) has the molecular formula C26H30Cl4N4O4 and a molecular weight of 604.36 g/mol. Its IUPAC name is 1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone;dihydrochloride.
| Compound Name | 1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 70539730 |
| Molecular Formula | C26H30Cl4N4O4 |
| Molecular Weight | 604.36 g/mol |
| Exact Mass | 602.10 |
| IUPAC Name | 1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone;dihydrochloride |
| SMILES | CC(=O)N1CCN(c2ccc(OC[C@@H]3CO[C@@](Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C26H28Cl2N4O4.2ClH/c1-19(33)31-10-12-32(13-11-31)21-3-5-22(6-4-21)34-15-23-16-35-26(36-23,17-30-9-8-29-18-30)24-7-2-20(27)14-25(24)28;;/h2-9,14,18,23H,10-13,15-17H2,1H3;2*1H/t23-,26-;;/m1../s1 |
| InChIKey | VURWDGJMDZQFQJ-HTOIPBTDSA-N |
| XLogP | 5.05 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|