C26H28Cl2N4O5 — CID 54407266
methyl 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine-1-carboxylate (PubChem CID 54407266) has the molecular formula C26H28Cl2N4O5 and a molecular weight of 547.44 g/mol. Its IUPAC name is methyl 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54407266 |
| Molecular Formula | C26H28Cl2N4O5 |
| Molecular Weight | 547.44 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | methyl 4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(c2ccc(OC[C@@H]3CO[C@@](Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
| InChI | InChI=1S/C26H28Cl2N4O5/c1-34-25(33)32-12-10-31(11-13-32)20-3-5-21(6-4-20)35-15-22-16-36-26(37-22,17-30-9-8-29-18-30)23-7-2-19(27)14-24(23)28/h2-9,14,18,22H,10-13,15-17H2,1H3/t22-,26-/m1/s1 |
| InChIKey | VRPHTGXCQQFDHQ-ATIYNZHBSA-N |
| XLogP | 4.43 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|