C27H28Cl2IN4O6S- — CID 142240232
[2-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2-oxoethyl]sulfanyliodanuidylformic acid (PubChem CID 142240232) has the molecular formula C27H28Cl2IN4O6S- and a molecular weight of 734.42 g/mol. Its IUPAC name is [2-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2-oxoethyl]sulfanyliodanuidylformic acid.
| Compound Name | [2-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2-oxoethyl]sulfanyliodanuidylformic acid |
|---|---|
| PubChem CID | 142240232 |
| Molecular Formula | C27H28Cl2IN4O6S- |
| Molecular Weight | 734.42 g/mol |
| Exact Mass | 733.02 |
| IUPAC Name | [2-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-2-oxoethyl]sulfanyliodanuidylformic acid |
| SMILES | O=C(O)[I-]SCC(=O)N1CCN(c2ccc(OCC3COC(Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
| InChI | InChI=1S/C27H28Cl2IN4O6S/c28-19-1-6-23(24(29)13-19)27(17-32-8-7-31-18-32)39-15-22(40-27)14-38-21-4-2-20(3-5-21)33-9-11-34(12-10-33)25(35)16-41-30-26(36)37/h1-8,13,18,22H,9-12,14-17H2,(H,36,37)/q-1 |
| InChIKey | KAPXKTRNDFSEQD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|