C31H31Cl2N5O5 — CID 13388842
1-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[(4-nitrophenyl)methyl]piperazine (PubChem CID 13388842) has the molecular formula C31H31Cl2N5O5 and a molecular weight of 624.53 g/mol. Its IUPAC name is 1-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[(4-nitrophenyl)methyl]piperazine.
| Compound Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[(4-nitrophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 13388842 |
| Molecular Formula | C31H31Cl2N5O5 |
| Molecular Weight | 624.53 g/mol |
| Exact Mass | 623.17 |
| IUPAC Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-[(4-nitrophenyl)methyl]piperazine |
| SMILES | O=[N+]([O-])c1ccc(CN2CCN(c3ccc(OCC4COC(Cn5ccnc5)(c5ccc(Cl)cc5Cl)O4)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H31Cl2N5O5/c32-24-3-10-29(30(33)17-24)31(21-36-12-11-34-22-36)42-20-28(43-31)19-41-27-8-6-25(7-9-27)37-15-13-35(14-16-37)18-23-1-4-26(5-2-23)38(39)40/h1-12,17,22,28H,13-16,18-21H2 |
| InChIKey | KIFXCVYCGKAJKA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 95.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|