C42H44Cl4N10O9 — CID 88771118
bis(1-amino-3-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]urea);hydrate (PubChem CID 88771118) has the molecular formula C42H44Cl4N10O9 and a molecular weight of 974.69 g/mol. Its IUPAC name is bis(1-amino-3-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]urea);hydrate.
| Compound Name | bis(1-amino-3-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]urea);hydrate |
|---|---|
| PubChem CID | 88771118 |
| Molecular Formula | C42H44Cl4N10O9 |
| Molecular Weight | 974.69 g/mol |
| Exact Mass | 972.20 |
| IUPAC Name | bis(1-amino-3-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]urea);hydrate |
| SMILES | NNC(=O)Nc1ccc(OCC2COC(Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1.NNC(=O)Nc1ccc(OCC2COC(Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1.O |
| InChI | InChI=1S/2C21H21Cl2N5O4.H2O/c2*22-14-1-6-18(19(23)9-14)21(12-28-8-7-25-13-28)31-11-17(32-21)10-30-16-4-2-15(3-5-16)26-20(29)27-24;/h2*1-9,13,17H,10-12,24H2,(H2,26,27,29);1H2 |
| InChIKey | VRZJDOCOOWPJCG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 256.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 65 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|