C23H24Cl2N4O3S — CID 12854690
1-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-3-ethylthiourea (PubChem CID 12854690) has the molecular formula C23H24Cl2N4O3S and a molecular weight of 507.44 g/mol. Its IUPAC name is 1-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-3-ethylthiourea.
| Compound Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-3-ethylthiourea |
|---|---|
| PubChem CID | 12854690 |
| Molecular Formula | C23H24Cl2N4O3S |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 1-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1ccc(OCC2COC(Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C23H24Cl2N4O3S/c1-2-27-22(33)28-17-4-6-18(7-5-17)30-12-19-13-31-23(32-19,14-29-10-9-26-15-29)20-8-3-16(24)11-21(20)25/h3-11,15,19H,2,12-14H2,1H3,(H2,27,28,33) |
| InChIKey | BMRBPJPOLWSJRI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 69.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|