C27H31Cl2N5O6 — CID 147484062
ethyl 2-[2-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]anilino]ethylcarbamoylamino]acetate (PubChem CID 147484062) has the molecular formula C27H31Cl2N5O6 and a molecular weight of 592.48 g/mol. Its IUPAC name is ethyl 2-[2-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]anilino]ethylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[2-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]anilino]ethylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 147484062 |
| Molecular Formula | C27H31Cl2N5O6 |
| Molecular Weight | 592.48 g/mol |
| Exact Mass | 591.17 |
| IUPAC Name | ethyl 2-[2-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]anilino]ethylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCCNc1ccc(OC[C@@H]2CO[C@@](Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C27H31Cl2N5O6/c1-2-37-25(35)14-33-26(36)32-10-9-31-20-4-6-21(7-5-20)38-15-22-16-39-27(40-22,17-34-12-11-30-18-34)23-8-3-19(28)13-24(23)29/h3-8,11-13,18,22,31H,2,9-10,14-17H2,1H3,(H2,32,33,36)/t22-,27-/m1/s1 |
| InChIKey | FEFNSLWDOPXMJO-AJTFRIOCSA-N |
| XLogP | 3.81 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|