C16H19Cl2N3O6 — CID 70588683
1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-(ethoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid (PubChem CID 70588683) has the molecular formula C16H19Cl2N3O6 and a molecular weight of 420.25 g/mol. Its IUPAC name is 1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-(ethoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid.
| Compound Name | 1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-(ethoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 70588683 |
| Molecular Formula | C16H19Cl2N3O6 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-(ethoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid |
| SMILES | CCOC[C@@H]1CO[C@@](Cn2ccnc2)(c2ccc(Cl)cc2Cl)O1.O=[N+]([O-])O |
| InChI | InChI=1S/C16H18Cl2N2O3.HNO3/c1-2-21-8-13-9-22-16(23-13,10-20-6-5-19-11-20)14-4-3-12(17)7-15(14)18;2-1(3)4/h3-7,11,13H,2,8-10H2,1H3;(H,2,3,4)/t13-,16-;/m1./s1 |
| InChIKey | DGRODDVMDZCDLP-OALZAMAHSA-N |
| XLogP | 3.15 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|