C22H30Cl2N2O3 — CID 54216423
1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-(octoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole (PubChem CID 54216423) has the molecular formula C22H30Cl2N2O3 and a molecular weight of 441.40 g/mol. Its IUPAC name is 1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-(octoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole.
| Compound Name | 1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-(octoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole |
|---|---|
| PubChem CID | 54216423 |
| Molecular Formula | C22H30Cl2N2O3 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-(octoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole |
| SMILES | CCCCCCCCOC[C@@H]1CO[C@@](Cn2ccnc2)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C22H30Cl2N2O3/c1-2-3-4-5-6-7-12-27-14-19-15-28-22(29-19,16-26-11-10-25-17-26)20-9-8-18(23)13-21(20)24/h8-11,13,17,19H,2-7,12,14-16H2,1H3/t19-,22-/m1/s1 |
| InChIKey | PZMXINVKGYMYCI-DENIHFKCSA-N |
| XLogP | 5.84 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|