C16H16Cl2N2O7 — CID 123132413
[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol;oxalic acid (PubChem CID 123132413) has the molecular formula C16H16Cl2N2O7 and a molecular weight of 419.22 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol;oxalic acid.
| Compound Name | [2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol;oxalic acid |
|---|---|
| PubChem CID | 123132413 |
| Molecular Formula | C16H16Cl2N2O7 |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OCC1COC(Cn2ccnc2)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C14H14Cl2N2O3.C2H2O4/c15-10-1-2-12(13(16)5-10)14(8-18-4-3-17-9-18)20-7-11(6-19)21-14;3-1(4)2(5)6/h1-5,9,11,19H,6-8H2;(H,3,4)(H,5,6) |
| InChIKey | CCRIZLZCAFWIAO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|