C27H30Cl2N4O3 — CID 54320612
1-[4-[4-[2-[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]ethyl]phenyl]piperazin-1-yl]ethanone (PubChem CID 54320612) has the molecular formula C27H30Cl2N4O3 and a molecular weight of 529.47 g/mol. Its IUPAC name is 1-[4-[4-[2-[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]ethyl]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[2-[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]ethyl]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 54320612 |
| Molecular Formula | C27H30Cl2N4O3 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 1-[4-[4-[2-[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]ethyl]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(CCC3COC(Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
| InChI | InChI=1S/C27H30Cl2N4O3/c1-20(34)32-12-14-33(15-13-32)23-6-2-21(3-7-23)4-8-24-17-35-27(36-24,18-31-11-10-30-19-31)25-9-5-22(28)16-26(25)29/h2-3,5-7,9-11,16,19,24H,4,8,12-15,17-18H2,1H3 |
| InChIKey | SRJIANUUOGAPEZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|