C21H20Cl2N4O7S — CID 88723666
1-[[2-(2,4-dichlorophenyl)-4-[(4-nitrophenyl)methylsulfanylmethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid (PubChem CID 88723666) has the molecular formula C21H20Cl2N4O7S and a molecular weight of 543.39 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenyl)-4-[(4-nitrophenyl)methylsulfanylmethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid.
| Compound Name | 1-[[2-(2,4-dichlorophenyl)-4-[(4-nitrophenyl)methylsulfanylmethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 88723666 |
| Molecular Formula | C21H20Cl2N4O7S |
| Molecular Weight | 543.39 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenyl)-4-[(4-nitrophenyl)methylsulfanylmethyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid |
| SMILES | O=[N+]([O-])O.O=[N+]([O-])c1ccc(CSCC2COC(Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C21H19Cl2N3O4S.HNO3/c22-16-3-6-19(20(23)9-16)21(13-25-8-7-24-14-25)29-10-18(30-21)12-31-11-15-1-4-17(5-2-15)26(27)28;2-1(3)4/h1-9,14,18H,10-13H2;(H,2,3,4) |
| InChIKey | RRXLPKGROLHCEK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|