C26H23ClFN3O6 — CID 70589282
1-[[(2S,4R)-2-(2-chloro-4-fluorophenyl)-4-[(4-phenylphenoxy)methyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid (PubChem CID 70589282) has the molecular formula C26H23ClFN3O6 and a molecular weight of 527.94 g/mol. Its IUPAC name is 1-[[(2S,4R)-2-(2-chloro-4-fluorophenyl)-4-[(4-phenylphenoxy)methyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid.
| Compound Name | 1-[[(2S,4R)-2-(2-chloro-4-fluorophenyl)-4-[(4-phenylphenoxy)methyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 70589282 |
| Molecular Formula | C26H23ClFN3O6 |
| Molecular Weight | 527.94 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 1-[[(2S,4R)-2-(2-chloro-4-fluorophenyl)-4-[(4-phenylphenoxy)methyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid |
| SMILES | Fc1ccc([C@]2(Cn3ccnc3)OC[C@@H](COc3ccc(-c4ccccc4)cc3)O2)c(Cl)c1.O=[N+]([O-])O |
| InChI | InChI=1S/C26H22ClFN2O3.HNO3/c27-25-14-21(28)8-11-24(25)26(17-30-13-12-29-18-30)32-16-23(33-26)15-31-22-9-6-20(7-10-22)19-4-2-1-3-5-19;2-1(3)4/h1-14,18,23H,15-17H2;(H,2,3,4)/t23-,26-;/m1./s1 |
| InChIKey | BFLSWKZPOYVISF-MIPPOABVSA-N |
| XLogP | 5.34 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.94 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|