C16H18Cl2N4O6 — CID 70552512
1-[[2-(2,4-dichlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;nitric acid (PubChem CID 70552512) has the molecular formula C16H18Cl2N4O6 and a molecular weight of 433.25 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;nitric acid.
| Compound Name | 1-[[2-(2,4-dichlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;nitric acid |
|---|---|
| PubChem CID | 70552512 |
| Molecular Formula | C16H18Cl2N4O6 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenyl)-4-(prop-2-enoxymethyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole;nitric acid |
| SMILES | C=CCOCC1COC(Cn2cncn2)(c2ccc(Cl)cc2Cl)O1.O=[N+]([O-])O |
| InChI | InChI=1S/C16H17Cl2N3O3.HNO3/c1-2-5-22-7-13-8-23-16(24-13,9-21-11-19-10-20-21)14-4-3-12(17)6-15(14)18;2-1(3)4/h2-4,6,10-11,13H,1,5,7-9H2;(H,2,3,4) |
| InChIKey | FNMHVUNMVANQGW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|