C13H12ClF4N3O2 — CID 145097088
5-chloro-2-[1-(1,1,2,2-tetrafluoroethoxy)-3-(1,2,4-triazol-1-yl)propan-2-yl]phenol (PubChem CID 145097088) has the molecular formula C13H12ClF4N3O2 and a molecular weight of 353.70 g/mol. Its IUPAC name is 5-chloro-2-[1-(1,1,2,2-tetrafluoroethoxy)-3-(1,2,4-triazol-1-yl)propan-2-yl]phenol.
| Compound Name | 5-chloro-2-[1-(1,1,2,2-tetrafluoroethoxy)-3-(1,2,4-triazol-1-yl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 145097088 |
| Molecular Formula | C13H12ClF4N3O2 |
| Molecular Weight | 353.70 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 5-chloro-2-[1-(1,1,2,2-tetrafluoroethoxy)-3-(1,2,4-triazol-1-yl)propan-2-yl]phenol |
| SMILES | Oc1cc(Cl)ccc1C(COC(F)(F)C(F)F)Cn1cncn1 |
| InChI | InChI=1S/C13H12ClF4N3O2/c14-9-1-2-10(11(22)3-9)8(4-21-7-19-6-20-21)5-23-13(17,18)12(15)16/h1-3,6-8,12,22H,4-5H2 |
| InChIKey | YXLOUKSHHFEQPX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|