C15H17Cl2N3O4 — CID 173429455
[2-butoxy-2-(2,4-dichlorophenyl)-1-imidazol-1-ylethyl] nitrate (PubChem CID 173429455) has the molecular formula C15H17Cl2N3O4 and a molecular weight of 374.22 g/mol. Its IUPAC name is [2-butoxy-2-(2,4-dichlorophenyl)-1-imidazol-1-ylethyl] nitrate.
| Compound Name | [2-butoxy-2-(2,4-dichlorophenyl)-1-imidazol-1-ylethyl] nitrate |
|---|---|
| PubChem CID | 173429455 |
| Molecular Formula | C15H17Cl2N3O4 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | [2-butoxy-2-(2,4-dichlorophenyl)-1-imidazol-1-ylethyl] nitrate |
| SMILES | CCCCOC(c1ccc(Cl)cc1Cl)C(O[N+](=O)[O-])n1ccnc1 |
| InChI | InChI=1S/C15H17Cl2N3O4/c1-2-3-8-23-14(12-5-4-11(16)9-13(12)17)15(24-20(21)22)19-7-6-18-10-19/h4-7,9-10,14-15H,2-3,8H2,1H3 |
| InChIKey | YOFFNPZPNJMZPA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|