C15H17Cl2N3O4 — CID 3038103
1-[(Z)-2-butoxy-2-(2,4-dichlorophenyl)ethenyl]imidazole;nitric acid (PubChem CID 3038103) has the molecular formula C15H17Cl2N3O4 and a molecular weight of 374.22 g/mol. Its IUPAC name is 1-[(Z)-2-butoxy-2-(2,4-dichlorophenyl)ethenyl]imidazole;nitric acid.
| Compound Name | 1-[(Z)-2-butoxy-2-(2,4-dichlorophenyl)ethenyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 3038103 |
| Molecular Formula | C15H17Cl2N3O4 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 1-[(Z)-2-butoxy-2-(2,4-dichlorophenyl)ethenyl]imidazole;nitric acid |
| SMILES | CCCCO/C(=C\n1ccnc1)c1ccc(Cl)cc1Cl.O=[N+]([O-])O |
| InChI | InChI=1S/C15H16Cl2N2O.HNO3/c1-2-3-8-20-15(10-19-7-6-18-11-19)13-5-4-12(16)9-14(13)17;2-1(3)4/h4-7,9-11H,2-3,8H2,1H3;(H,2,3,4)/b15-10-; |
| InChIKey | MFOUOQOBNZLFAS-AZJSCORLSA-N |
| XLogP | 4.61 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|