C18H15BrCl2N2O2S — CID 54273671
1-[2-[2-[(5-bromothiophen-2-yl)methoxy]ethoxy]-2-(2,4-dichlorophenyl)ethenyl]imidazole (PubChem CID 54273671) has the molecular formula C18H15BrCl2N2O2S and a molecular weight of 474.21 g/mol. Its IUPAC name is 1-[2-[2-[(5-bromothiophen-2-yl)methoxy]ethoxy]-2-(2,4-dichlorophenyl)ethenyl]imidazole.
| Compound Name | 1-[2-[2-[(5-bromothiophen-2-yl)methoxy]ethoxy]-2-(2,4-dichlorophenyl)ethenyl]imidazole |
|---|---|
| PubChem CID | 54273671 |
| Molecular Formula | C18H15BrCl2N2O2S |
| Molecular Weight | 474.21 g/mol |
| Exact Mass | 471.94 |
| IUPAC Name | 1-[2-[2-[(5-bromothiophen-2-yl)methoxy]ethoxy]-2-(2,4-dichlorophenyl)ethenyl]imidazole |
| SMILES | Clc1ccc(C(=Cn2ccnc2)OCCOCc2ccc(Br)s2)c(Cl)c1 |
| InChI | InChI=1S/C18H15BrCl2N2O2S/c19-18-4-2-14(26-18)11-24-7-8-25-17(10-23-6-5-22-12-23)15-3-1-13(20)9-16(15)21/h1-6,9-10,12H,7-8,11H2 |
| InChIKey | RLXDCPZXLZRFSE-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.21 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|