C17H20Cl2N2 — CID 70462354
1-[(E)-2-(2,4-dichlorophenyl)oct-1-enyl]imidazole (PubChem CID 70462354) has the molecular formula C17H20Cl2N2 and a molecular weight of 323.27 g/mol. Its IUPAC name is 1-[(E)-2-(2,4-dichlorophenyl)oct-1-enyl]imidazole.
| Compound Name | 1-[(E)-2-(2,4-dichlorophenyl)oct-1-enyl]imidazole |
|---|---|
| PubChem CID | 70462354 |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-[(E)-2-(2,4-dichlorophenyl)oct-1-enyl]imidazole |
| SMILES | CCCCCC/C(=C\n1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H20Cl2N2/c1-2-3-4-5-6-14(12-21-10-9-20-13-21)16-8-7-15(18)11-17(16)19/h7-13H,2-6H2,1H3/b14-12+ |
| InChIKey | XGLMGIZXONNUMU-WYMLVPIESA-N |
| XLogP | 6.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|