C18H22Cl2N2O — CID 70531903
1-[(Z)-1-(2,4-dichlorophenyl)-1-hexoxyprop-1-en-2-yl]imidazole (PubChem CID 70531903) has the molecular formula C18H22Cl2N2O and a molecular weight of 353.29 g/mol. Its IUPAC name is 1-[(Z)-1-(2,4-dichlorophenyl)-1-hexoxyprop-1-en-2-yl]imidazole.
| Compound Name | 1-[(Z)-1-(2,4-dichlorophenyl)-1-hexoxyprop-1-en-2-yl]imidazole |
|---|---|
| PubChem CID | 70531903 |
| Molecular Formula | C18H22Cl2N2O |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-[(Z)-1-(2,4-dichlorophenyl)-1-hexoxyprop-1-en-2-yl]imidazole |
| SMILES | CCCCCCO/C(=C(/C)n1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H22Cl2N2O/c1-3-4-5-6-11-23-18(14(2)22-10-9-21-13-22)16-8-7-15(19)12-17(16)20/h7-10,12-13H,3-6,11H2,1-2H3/b18-14- |
| InChIKey | VOKXHYUOJYFPAG-JXAWBTAJSA-N |
| XLogP | 6.13 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|