C17H20Cl2N2O — CID 54083006
1-(2,4-dichlorophenyl)-4-ethyl-2-imidazol-1-ylhex-2-en-1-ol (PubChem CID 54083006) has the molecular formula C17H20Cl2N2O and a molecular weight of 339.27 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-ethyl-2-imidazol-1-ylhex-2-en-1-ol.
| Compound Name | 1-(2,4-dichlorophenyl)-4-ethyl-2-imidazol-1-ylhex-2-en-1-ol |
|---|---|
| PubChem CID | 54083006 |
| Molecular Formula | C17H20Cl2N2O |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-ethyl-2-imidazol-1-ylhex-2-en-1-ol |
| SMILES | CCC(C=C(C(O)c1ccc(Cl)cc1Cl)n1ccnc1)CC |
| InChI | InChI=1S/C17H20Cl2N2O/c1-3-12(4-2)9-16(21-8-7-20-11-21)17(22)14-6-5-13(18)10-15(14)19/h5-12,17,22H,3-4H2,1-2H3 |
| InChIKey | MOLHMNMYGSFPKE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |