C11H10Cl2N2O — CID 853401
(1R)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol (PubChem CID 853401) has the molecular formula C11H10Cl2N2O and a molecular weight of 257.12 g/mol. Its IUPAC name is (1R)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol.
| Compound Name | (1R)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol |
|---|---|
| PubChem CID | 853401 |
| Molecular Formula | C11H10Cl2N2O |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | (1R)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol |
| SMILES | O[C@@H](Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O/c12-8-1-2-9(10(13)5-8)11(16)6-15-4-3-14-7-15/h1-5,7,11,16H,6H2/t11-/m0/s1 |
| InChIKey | UKVLTPAGJIYSGN-NSHDSACASA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |