C12H11Cl2N3OS — CID 140542063
O-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] carbamothioate (PubChem CID 140542063) has the molecular formula C12H11Cl2N3OS and a molecular weight of 316.21 g/mol. Its IUPAC name is O-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] carbamothioate.
| Compound Name | O-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] carbamothioate |
|---|---|
| PubChem CID | 140542063 |
| Molecular Formula | C12H11Cl2N3OS |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | O-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] carbamothioate |
| SMILES | NC(=S)OC(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N3OS/c13-8-1-2-9(10(14)5-8)11(18-12(15)19)6-17-4-3-16-7-17/h1-5,7,11H,6H2,(H2,15,19) |
| InChIKey | OWOPAZXBLXARGK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|