C15H14Cl2N2O2S — CID 154775836
[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] 3-methylsulfanylprop-2-enoate (PubChem CID 154775836) has the molecular formula C15H14Cl2N2O2S and a molecular weight of 357.26 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] 3-methylsulfanylprop-2-enoate.
| Compound Name | [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] 3-methylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 154775836 |
| Molecular Formula | C15H14Cl2N2O2S |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] 3-methylsulfanylprop-2-enoate |
| SMILES | CSC=CC(=O)OC(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N2O2S/c1-22-7-4-15(20)21-14(9-19-6-5-18-10-19)12-3-2-11(16)8-13(12)17/h2-8,10,14H,9H2,1H3 |
| InChIKey | VRPQLOWBINSTRR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|