C16H18Cl2N2O — CID 3009148
1-[2-(2,4-dichlorophenyl)-2-pent-4-enoxyethyl]imidazole (PubChem CID 3009148) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-pent-4-enoxyethyl]imidazole.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-pent-4-enoxyethyl]imidazole |
|---|---|
| PubChem CID | 3009148 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-pent-4-enoxyethyl]imidazole |
| SMILES | C=CCCCOC(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O/c1-2-3-4-9-21-16(11-20-8-7-19-12-20)14-6-5-13(17)10-15(14)18/h2,5-8,10,12,16H,1,3-4,9,11H2 |
| InChIKey | DCCYGVRIRXBUSK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|