C19H15Cl5N2OS — CID 154207042
1-[2-(2,4-dichlorophenyl)-2-[2-(2,4,5-trichlorophenyl)sulfanylethoxy]ethyl]imidazole (PubChem CID 154207042) has the molecular formula C19H15Cl5N2OS and a molecular weight of 496.67 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-[2-(2,4,5-trichlorophenyl)sulfanylethoxy]ethyl]imidazole.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-[2-(2,4,5-trichlorophenyl)sulfanylethoxy]ethyl]imidazole |
|---|---|
| PubChem CID | 154207042 |
| Molecular Formula | C19H15Cl5N2OS |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 493.93 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-[2-(2,4,5-trichlorophenyl)sulfanylethoxy]ethyl]imidazole |
| SMILES | Clc1ccc(C(Cn2ccnc2)OCCSc2cc(Cl)c(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H15Cl5N2OS/c20-12-1-2-13(14(21)7-12)18(10-26-4-3-25-11-26)27-5-6-28-19-9-16(23)15(22)8-17(19)24/h1-4,7-9,11,18H,5-6,10H2 |
| InChIKey | FLPVOKHRCNIABM-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|