C18H15BrCl2N2OS — CID 3054908
1-[2-[(4-bromophenyl)sulfanylmethoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole (PubChem CID 3054908) has the molecular formula C18H15BrCl2N2OS and a molecular weight of 458.21 g/mol. Its IUPAC name is 1-[2-[(4-bromophenyl)sulfanylmethoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole.
| Compound Name | 1-[2-[(4-bromophenyl)sulfanylmethoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole |
|---|---|
| PubChem CID | 3054908 |
| Molecular Formula | C18H15BrCl2N2OS |
| Molecular Weight | 458.21 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | 1-[2-[(4-bromophenyl)sulfanylmethoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole |
| SMILES | Clc1ccc(C(Cn2ccnc2)OCSc2ccc(Br)cc2)c(Cl)c1 |
| InChI | InChI=1S/C18H15BrCl2N2OS/c19-13-1-4-15(5-2-13)25-12-24-18(10-23-8-7-22-11-23)16-6-3-14(20)9-17(16)21/h1-9,11,18H,10,12H2 |
| InChIKey | NKFBIKRSAFFCMW-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.21 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|