C20H20BrCl2N3S — CID 14156808
3-(4-bromophenyl)sulfanyl-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]propan-1-amine (PubChem CID 14156808) has the molecular formula C20H20BrCl2N3S and a molecular weight of 485.28 g/mol. Its IUPAC name is 3-(4-bromophenyl)sulfanyl-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]propan-1-amine.
| Compound Name | 3-(4-bromophenyl)sulfanyl-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 14156808 |
| Molecular Formula | C20H20BrCl2N3S |
| Molecular Weight | 485.28 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | 3-(4-bromophenyl)sulfanyl-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]propan-1-amine |
| SMILES | Clc1ccc(C(Cn2ccnc2)NCCCSc2ccc(Br)cc2)c(Cl)c1 |
| InChI | InChI=1S/C20H20BrCl2N3S/c21-15-2-5-17(6-3-15)27-11-1-8-25-20(13-26-10-9-24-14-26)18-7-4-16(22)12-19(18)23/h2-7,9-10,12,14,20,25H,1,8,11,13H2 |
| InChIKey | XJBZSEIPNPBZTM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.28 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|