C18H14Cl4N2S2 — CID 21423702
1-[2,3-bis[(2,4-dichlorophenyl)sulfanyl]propyl]imidazole (PubChem CID 21423702) has the molecular formula C18H14Cl4N2S2 and a molecular weight of 464.27 g/mol. Its IUPAC name is 1-[2,3-bis[(2,4-dichlorophenyl)sulfanyl]propyl]imidazole.
| Compound Name | 1-[2,3-bis[(2,4-dichlorophenyl)sulfanyl]propyl]imidazole |
|---|---|
| PubChem CID | 21423702 |
| Molecular Formula | C18H14Cl4N2S2 |
| Molecular Weight | 464.27 g/mol |
| Exact Mass | 461.94 |
| IUPAC Name | 1-[2,3-bis[(2,4-dichlorophenyl)sulfanyl]propyl]imidazole |
| SMILES | Clc1ccc(SCC(Cn2ccnc2)Sc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl4N2S2/c19-12-1-3-17(15(21)7-12)25-10-14(9-24-6-5-23-11-24)26-18-4-2-13(20)8-16(18)22/h1-8,11,14H,9-10H2 |
| InChIKey | BXIXRAVATIKDDG-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.27 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |