C15H18Cl2N2S2 — CID 54038538
1-[2-(3,4-dichlorophenyl)sulfanyl-3-propylsulfanylpropyl]imidazole (PubChem CID 54038538) has the molecular formula C15H18Cl2N2S2 and a molecular weight of 361.36 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)sulfanyl-3-propylsulfanylpropyl]imidazole.
| Compound Name | 1-[2-(3,4-dichlorophenyl)sulfanyl-3-propylsulfanylpropyl]imidazole |
|---|---|
| PubChem CID | 54038538 |
| Molecular Formula | C15H18Cl2N2S2 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)sulfanyl-3-propylsulfanylpropyl]imidazole |
| SMILES | CCCSCC(Cn1ccnc1)Sc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H18Cl2N2S2/c1-2-7-20-10-13(9-19-6-5-18-11-19)21-12-3-4-14(16)15(17)8-12/h3-6,8,11,13H,2,7,9-10H2,1H3 |
| InChIKey | LKROLGATTRAKPG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|