C17H11Cl5N2S — CID 21402409
1-[2-(3,4-dichlorophenyl)-2-(3,4,5-trichlorophenyl)sulfanylethyl]imidazole (PubChem CID 21402409) has the molecular formula C17H11Cl5N2S and a molecular weight of 452.62 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)-2-(3,4,5-trichlorophenyl)sulfanylethyl]imidazole.
| Compound Name | 1-[2-(3,4-dichlorophenyl)-2-(3,4,5-trichlorophenyl)sulfanylethyl]imidazole |
|---|---|
| PubChem CID | 21402409 |
| Molecular Formula | C17H11Cl5N2S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 449.91 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)-2-(3,4,5-trichlorophenyl)sulfanylethyl]imidazole |
| SMILES | Clc1ccc(C(Cn2ccnc2)Sc2cc(Cl)c(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C17H11Cl5N2S/c18-12-2-1-10(5-13(12)19)16(8-24-4-3-23-9-24)25-11-6-14(20)17(22)15(21)7-11/h1-7,9,16H,8H2 |
| InChIKey | MAVPCBSJMLILCO-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|