C13H12Cl2N2O — CID 54433379
(3S)-3-(3,4-dichlorophenyl)-4-imidazol-1-ylbutanal (PubChem CID 54433379) has the molecular formula C13H12Cl2N2O and a molecular weight of 283.16 g/mol. Its IUPAC name is (3S)-3-(3,4-dichlorophenyl)-4-imidazol-1-ylbutanal.
| Compound Name | (3S)-3-(3,4-dichlorophenyl)-4-imidazol-1-ylbutanal |
|---|---|
| PubChem CID | 54433379 |
| Molecular Formula | C13H12Cl2N2O |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (3S)-3-(3,4-dichlorophenyl)-4-imidazol-1-ylbutanal |
| SMILES | O=CC[C@H](Cn1ccnc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N2O/c14-12-2-1-10(7-13(12)15)11(3-6-18)8-17-5-4-16-9-17/h1-2,4-7,9,11H,3,8H2/t11-/m1/s1 |
| InChIKey | WJBMONNMVOFXKB-LLVKDONJSA-N |
| XLogP | 3.56 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|