C19H17Cl3N2S — CID 122613849
1-(4-chlorophenyl)-3-(2,6-dichlorophenyl)-4-imidazol-1-ylbutane-1-thiol (PubChem CID 122613849) has the molecular formula C19H17Cl3N2S and a molecular weight of 411.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2,6-dichlorophenyl)-4-imidazol-1-ylbutane-1-thiol.
| Compound Name | 1-(4-chlorophenyl)-3-(2,6-dichlorophenyl)-4-imidazol-1-ylbutane-1-thiol |
|---|---|
| PubChem CID | 122613849 |
| Molecular Formula | C19H17Cl3N2S |
| Molecular Weight | 411.79 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2,6-dichlorophenyl)-4-imidazol-1-ylbutane-1-thiol |
| SMILES | SC(CC(Cn1ccnc1)c1c(Cl)cccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17Cl3N2S/c20-15-6-4-13(5-7-15)18(25)10-14(11-24-9-8-23-12-24)19-16(21)2-1-3-17(19)22/h1-9,12,14,18,25H,10-11H2 |
| InChIKey | LTQZBEATVZOFGR-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.79 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|