C19H17Cl3N2 — CID 3006905
1-[4-(2-chlorophenyl)-2-(2,4-dichlorophenyl)butyl]imidazole (PubChem CID 3006905) has the molecular formula C19H17Cl3N2 and a molecular weight of 379.72 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)-2-(2,4-dichlorophenyl)butyl]imidazole.
| Compound Name | 1-[4-(2-chlorophenyl)-2-(2,4-dichlorophenyl)butyl]imidazole |
|---|---|
| PubChem CID | 3006905 |
| Molecular Formula | C19H17Cl3N2 |
| Molecular Weight | 379.72 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 1-[4-(2-chlorophenyl)-2-(2,4-dichlorophenyl)butyl]imidazole |
| SMILES | Clc1ccc(C(CCc2ccccc2Cl)Cn2ccnc2)c(Cl)c1 |
| InChI | InChI=1S/C19H17Cl3N2/c20-16-7-8-17(19(22)11-16)15(12-24-10-9-23-13-24)6-5-14-3-1-2-4-18(14)21/h1-4,7-11,13,15H,5-6,12H2 |
| InChIKey | SBFGKGMTNIHBJF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.72 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |