C24H20Cl2N2O2 — CID 3054902
1-[2-(2,4-dichlorophenyl)-2-[(4-phenylphenoxy)methoxy]ethyl]imidazole (PubChem CID 3054902) has the molecular formula C24H20Cl2N2O2 and a molecular weight of 439.34 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-[(4-phenylphenoxy)methoxy]ethyl]imidazole.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-[(4-phenylphenoxy)methoxy]ethyl]imidazole |
|---|---|
| PubChem CID | 3054902 |
| Molecular Formula | C24H20Cl2N2O2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-[(4-phenylphenoxy)methoxy]ethyl]imidazole |
| SMILES | Clc1ccc(C(Cn2ccnc2)OCOc2ccc(-c3ccccc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C24H20Cl2N2O2/c25-20-8-11-22(23(26)14-20)24(15-28-13-12-27-16-28)30-17-29-21-9-6-19(7-10-21)18-4-2-1-3-5-18/h1-14,16,24H,15,17H2 |
| InChIKey | SNUPHUAJQNGPIF-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|