C19H13Cl2N3O3 — CID 10949425
2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]isoindole-1,3-dione (PubChem CID 10949425) has the molecular formula C19H13Cl2N3O3 and a molecular weight of 402.24 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]isoindole-1,3-dione.
| Compound Name | 2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10949425 |
| Molecular Formula | C19H13Cl2N3O3 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OC(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H13Cl2N3O3/c20-12-5-6-15(16(21)9-12)17(10-23-8-7-22-11-23)27-24-18(25)13-3-1-2-4-14(13)19(24)26/h1-9,11,17H,10H2 |
| InChIKey | XOYSSEFNTSXDRN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|