C14H14Cl2N2O — CID 54337740
1-[2-(2,4-dichlorophenyl)-2-prop-1-enoxyethyl]imidazole (PubChem CID 54337740) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.19 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-prop-1-enoxyethyl]imidazole.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-prop-1-enoxyethyl]imidazole |
|---|---|
| PubChem CID | 54337740 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-prop-1-enoxyethyl]imidazole |
| SMILES | CC=COC(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16/h2-8,10,14H,9H2,1H3 |
| InChIKey | TWSDEFZXYDXWQC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|