C19H14Cl4N2OS — CID 54353590
O-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] 2-(2,4-dichlorophenyl)ethanethioate (PubChem CID 54353590) has the molecular formula C19H14Cl4N2OS and a molecular weight of 460.21 g/mol. Its IUPAC name is O-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] 2-(2,4-dichlorophenyl)ethanethioate.
| Compound Name | O-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] 2-(2,4-dichlorophenyl)ethanethioate |
|---|---|
| PubChem CID | 54353590 |
| Molecular Formula | C19H14Cl4N2OS |
| Molecular Weight | 460.21 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | O-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] 2-(2,4-dichlorophenyl)ethanethioate |
| SMILES | S=C(Cc1ccc(Cl)cc1Cl)OC(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H14Cl4N2OS/c20-13-2-1-12(16(22)8-13)7-19(27)26-18(10-25-6-5-24-11-25)15-4-3-14(21)9-17(15)23/h1-6,8-9,11,18H,7,10H2 |
| InChIKey | UHNIGRLKVAHREZ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.21 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|