C18H22Cl2N2O2S — CID 54137183
[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]-hexoxymethanethione (PubChem CID 54137183) has the molecular formula C18H22Cl2N2O2S and a molecular weight of 401.36 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]-hexoxymethanethione.
| Compound Name | [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]-hexoxymethanethione |
|---|---|
| PubChem CID | 54137183 |
| Molecular Formula | C18H22Cl2N2O2S |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]-hexoxymethanethione |
| SMILES | CCCCCCOC(=S)OC(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H22Cl2N2O2S/c1-2-3-4-5-10-23-18(25)24-17(12-22-9-8-21-13-22)15-7-6-14(19)11-16(15)20/h6-9,11,13,17H,2-5,10,12H2,1H3 |
| InChIKey | NYOBSXUIISWJJL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|