C19H18BrCl2N3O5 — CID 24838966
1-[2-[2-(4-bromophenoxy)ethoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole;nitric acid (PubChem CID 24838966) has the molecular formula C19H18BrCl2N3O5 and a molecular weight of 519.18 g/mol. Its IUPAC name is 1-[2-[2-(4-bromophenoxy)ethoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole;nitric acid.
| Compound Name | 1-[2-[2-(4-bromophenoxy)ethoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 24838966 |
| Molecular Formula | C19H18BrCl2N3O5 |
| Molecular Weight | 519.18 g/mol |
| Exact Mass | 516.98 |
| IUPAC Name | 1-[2-[2-(4-bromophenoxy)ethoxy]-2-(2,4-dichlorophenyl)ethyl]imidazole;nitric acid |
| SMILES | Clc1ccc(C(Cn2ccnc2)OCCOc2ccc(Br)cc2)c(Cl)c1.O=[N+]([O-])O |
| InChI | InChI=1S/C19H17BrCl2N2O2.HNO3/c20-14-1-4-16(5-2-14)25-9-10-26-19(12-24-8-7-23-13-24)17-6-3-15(21)11-18(17)22;2-1(3)4/h1-8,11,13,19H,9-10,12H2;(H,2,3,4) |
| InChIKey | FAOFODYYJXOSKW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.18 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|