C19H16Cl2N2S3 — CID 88823753
[1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-(4-chlorophenyl)-2-sulfanylethanedithioate (PubChem CID 88823753) has the molecular formula C19H16Cl2N2S3 and a molecular weight of 439.46 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-(4-chlorophenyl)-2-sulfanylethanedithioate.
| Compound Name | [1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-(4-chlorophenyl)-2-sulfanylethanedithioate |
|---|---|
| PubChem CID | 88823753 |
| Molecular Formula | C19H16Cl2N2S3 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | [1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-(4-chlorophenyl)-2-sulfanylethanedithioate |
| SMILES | S=C(SC(Cn1ccnc1)c1ccc(Cl)cc1)C(S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N2S3/c20-15-5-1-13(2-6-15)17(11-23-10-9-22-12-23)26-19(25)18(24)14-3-7-16(21)8-4-14/h1-10,12,17-18,24H,11H2 |
| InChIKey | CDRFTJFQZIWLSL-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|