C19H14Cl4N2OS — CID 21422308
S-[2-imidazol-1-yl-1-(2,4,6-trichlorophenyl)ethyl] 2-(4-chlorophenyl)ethanethioate (PubChem CID 21422308) has the molecular formula C19H14Cl4N2OS and a molecular weight of 460.21 g/mol. Its IUPAC name is S-[2-imidazol-1-yl-1-(2,4,6-trichlorophenyl)ethyl] 2-(4-chlorophenyl)ethanethioate.
| Compound Name | S-[2-imidazol-1-yl-1-(2,4,6-trichlorophenyl)ethyl] 2-(4-chlorophenyl)ethanethioate |
|---|---|
| PubChem CID | 21422308 |
| Molecular Formula | C19H14Cl4N2OS |
| Molecular Weight | 460.21 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | S-[2-imidazol-1-yl-1-(2,4,6-trichlorophenyl)ethyl] 2-(4-chlorophenyl)ethanethioate |
| SMILES | O=C(Cc1ccc(Cl)cc1)SC(Cn1ccnc1)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C19H14Cl4N2OS/c20-13-3-1-12(2-4-13)7-18(26)27-17(10-25-6-5-24-11-25)19-15(22)8-14(21)9-16(19)23/h1-6,8-9,11,17H,7,10H2 |
| InChIKey | KHBFPIHNZSSWKR-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.21 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|