C18H13Cl3N2OS2 — CID 54050491
O-(2,4-dichlorophenyl) [1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate (PubChem CID 54050491) has the molecular formula C18H13Cl3N2OS2 and a molecular weight of 443.81 g/mol. Its IUPAC name is O-(2,4-dichlorophenyl) [1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate.
| Compound Name | O-(2,4-dichlorophenyl) [1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 54050491 |
| Molecular Formula | C18H13Cl3N2OS2 |
| Molecular Weight | 443.81 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | O-(2,4-dichlorophenyl) [1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate |
| SMILES | S=C(Oc1ccc(Cl)cc1Cl)SC(Cn1ccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13Cl3N2OS2/c19-13-3-1-12(2-4-13)17(10-23-8-7-22-11-23)26-18(25)24-16-6-5-14(20)9-15(16)21/h1-9,11,17H,10H2 |
| InChIKey | LSNZHSXQOZIDBF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.81 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|