C16H19ClN2OS2 — CID 88823725
S-[1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-sulfanylpentanethioate (PubChem CID 88823725) has the molecular formula C16H19ClN2OS2 and a molecular weight of 354.93 g/mol. Its IUPAC name is S-[1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-sulfanylpentanethioate.
| Compound Name | S-[1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-sulfanylpentanethioate |
|---|---|
| PubChem CID | 88823725 |
| Molecular Formula | C16H19ClN2OS2 |
| Molecular Weight | 354.93 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | S-[1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-sulfanylpentanethioate |
| SMILES | CCCC(S)C(=O)SC(Cn1ccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClN2OS2/c1-2-3-14(21)16(20)22-15(10-19-9-8-18-11-19)12-4-6-13(17)7-5-12/h4-9,11,14-15,21H,2-3,10H2,1H3 |
| InChIKey | AVPAPPMBTPLOON-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 34.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|