C13H11Cl3N2OS — CID 21422331
S-[2-imidazol-1-yl-1-(2,4,6-trichlorophenyl)ethyl] ethanethioate (PubChem CID 21422331) has the molecular formula C13H11Cl3N2OS and a molecular weight of 349.67 g/mol. Its IUPAC name is S-[2-imidazol-1-yl-1-(2,4,6-trichlorophenyl)ethyl] ethanethioate.
| Compound Name | S-[2-imidazol-1-yl-1-(2,4,6-trichlorophenyl)ethyl] ethanethioate |
|---|---|
| PubChem CID | 21422331 |
| Molecular Formula | C13H11Cl3N2OS |
| Molecular Weight | 349.67 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | S-[2-imidazol-1-yl-1-(2,4,6-trichlorophenyl)ethyl] ethanethioate |
| SMILES | CC(=O)SC(Cn1ccnc1)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl3N2OS/c1-8(19)20-12(6-18-3-2-17-7-18)13-10(15)4-9(14)5-11(13)16/h2-5,7,12H,6H2,1H3 |
| InChIKey | UFFZYTFUSONGHQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.67 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|