C19H25ClN2OS — CID 21422336
S-[1-(4-chlorophenyl)-2-imidazol-1-ylethyl] octanethioate (PubChem CID 21422336) has the molecular formula C19H25ClN2OS and a molecular weight of 364.94 g/mol. Its IUPAC name is S-[1-(4-chlorophenyl)-2-imidazol-1-ylethyl] octanethioate.
| Compound Name | S-[1-(4-chlorophenyl)-2-imidazol-1-ylethyl] octanethioate |
|---|---|
| PubChem CID | 21422336 |
| Molecular Formula | C19H25ClN2OS |
| Molecular Weight | 364.94 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | S-[1-(4-chlorophenyl)-2-imidazol-1-ylethyl] octanethioate |
| SMILES | CCCCCCCC(=O)SC(Cn1ccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H25ClN2OS/c1-2-3-4-5-6-7-19(23)24-18(14-22-13-12-21-15-22)16-8-10-17(20)11-9-16/h8-13,15,18H,2-7,14H2,1H3 |
| InChIKey | YZBGYUHFYVHNCD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.94 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|