C18H17ClN2S — CID 21402207
1-[2-(4-chlorophenyl)-2-(4-methylphenyl)sulfanylethyl]imidazole (PubChem CID 21402207) has the molecular formula C18H17ClN2S and a molecular weight of 328.87 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-(4-methylphenyl)sulfanylethyl]imidazole.
| Compound Name | 1-[2-(4-chlorophenyl)-2-(4-methylphenyl)sulfanylethyl]imidazole |
|---|---|
| PubChem CID | 21402207 |
| Molecular Formula | C18H17ClN2S |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-(4-methylphenyl)sulfanylethyl]imidazole |
| SMILES | Cc1ccc(SC(Cn2ccnc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H17ClN2S/c1-14-2-8-17(9-3-14)22-18(12-21-11-10-20-13-21)15-4-6-16(19)7-5-15/h2-11,13,18H,12H2,1H3 |
| InChIKey | NZJMNJCDYUEHAV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |